About 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine
2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine (PubChem CID 3337838) has the molecular formula C18H14N2OS3
and a molecular weight of 370.52 g/mol. Its IUPAC name is 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
| PubChem CID | 3337838 |
| Molecular Formula | C18H14N2OS3 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
| SMILES | CS(=O)c1sc2nc(-c3cccs3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C18H14N2OS3/c1-24(21)18-16(19)15-12(11-6-3-2-4-7-11)10-13(20-17(15)23-18)14-8-5-9-22-14/h2-10H,19H2,1H3 |
| InChIKey | BCCLLEGQIPOMJZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
The IUPAC name of 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine (CID 3337838) is 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine.
What is the SMILES notation for 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
The canonical SMILES for 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine is CS(=O)c1sc2nc(-c3cccs3)cc(-c3ccccc3)c2c1N.
What is the InChIKey of 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
The InChIKey is BCCLLEGQIPOMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2OS3/c1-24(21)18-16(19)15-12(11-6-3-2-4-7-11)10-13(20-17(15)23-18)14-8-5-9-22-14/h2-10H,19H2,1H3.
What are the key properties of 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine?
2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine has a molecular weight of 370.52 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine is sourced from PubChem (CID 3337838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).