C19H24N8O5 — CID 3338224
N-[(2-methoxy-3-nitrophenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 3338224) has the molecular formula C19H24N8O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is N-[(2-methoxy-3-nitrophenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(2-methoxy-3-nitrophenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3338224 |
| Molecular Formula | C19H24N8O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[(2-methoxy-3-nitrophenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | COc1c(C=NNc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N8O5/c1-30-16-14(3-2-4-15(16)27(28)29)13-20-24-17-21-18(25-5-9-31-10-6-25)23-19(22-17)26-7-11-32-12-8-26/h2-4,13H,5-12H2,1H3,(H,21,22,23,24) |
| InChIKey | BDILAMBHYGKYTL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 140.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|