C23H18Cl2N2O4 — CID 3338510
[4-[[[2-(2,3-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 3338510) has the molecular formula C23H18Cl2N2O4 and a molecular weight of 457.31 g/mol. Its IUPAC name is [4-[[[2-(2,3-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-[[[2-(2,3-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 3338510 |
| Molecular Formula | C23H18Cl2N2O4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [4-[[[2-(2,3-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(C=NNC(=O)COc3cccc(Cl)c3Cl)cc2)c1 |
| InChI | InChI=1S/C23H18Cl2N2O4/c1-15-4-2-5-17(12-15)23(29)31-18-10-8-16(9-11-18)13-26-27-21(28)14-30-20-7-3-6-19(24)22(20)25/h2-13H,14H2,1H3,(H,27,28) |
| InChIKey | JIZRZFJYGAVHSF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|