About N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide
N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide (PubChem CID 3338867) has the molecular formula C17H19N5O5
and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide.
Molecular Properties
| Compound Name | N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide |
| PubChem CID | 3338867 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2C(CO)OC(CO)CO)c1ccccc1 |
| InChI | InChI=1S/C17H19N5O5/c23-6-12(7-24)27-13(8-25)22-10-20-14-15(18-9-19-16(14)22)21-17(26)11-4-2-1-3-5-11/h1-5,9-10,12-13,23-25H,6-8H2,(H,18,19,21,26) |
| InChIKey | SXELZTFNKQYQAR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide?
The IUPAC name of N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide (CID 3338867) is N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide.
What is the SMILES notation for N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide?
The canonical SMILES for N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide is O=C(Nc1ncnc2c1ncn2C(CO)OC(CO)CO)c1ccccc1.
What is the InChIKey of N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide?
The InChIKey is SXELZTFNKQYQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O5/c23-6-12(7-24)27-13(8-25)22-10-20-14-15(18-9-19-16(14)22)21-17(26)11-4-2-1-3-5-11/h1-5,9-10,12-13,23-25H,6-8H2,(H,18,19,21,26).
What are the key properties of N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide?
N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide has a molecular weight of 373.37 g/mol, XLogP of -0.06, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[9-[1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethyl]purin-6-yl]benzamide is sourced from PubChem (CID 3338867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).