About N-cyclopropylbutanamide
N-cyclopropylbutanamide (PubChem CID 3339101) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is N-cyclopropylbutanamide.
Molecular Properties
| Compound Name | N-cyclopropylbutanamide |
| PubChem CID | 3339101 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | N-cyclopropylbutanamide |
| SMILES | CCCC(=O)NC1CC1 |
| InChI | InChI=1S/C7H13NO/c1-2-3-7(9)8-6-4-5-6/h6H,2-5H2,1H3,(H,8,9) |
| InChIKey | RIORBKZTLFEWDG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropylbutanamide?
The IUPAC name of N-cyclopropylbutanamide (CID 3339101) is N-cyclopropylbutanamide.
What is the SMILES notation for N-cyclopropylbutanamide?
The canonical SMILES for N-cyclopropylbutanamide is CCCC(=O)NC1CC1.
What is the InChIKey of N-cyclopropylbutanamide?
The InChIKey is RIORBKZTLFEWDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-2-3-7(9)8-6-4-5-6/h6H,2-5H2,1H3,(H,8,9).
What are the key properties of N-cyclopropylbutanamide?
N-cyclopropylbutanamide has a molecular weight of 127.19 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropylbutanamide is sourced from PubChem (CID 3339101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).