C16H20BrN3O2S — CID 3339497
4-bromo-N,N-diethyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 3339497) has the molecular formula C16H20BrN3O2S and a molecular weight of 398.33 g/mol. Its IUPAC name is 4-bromo-N,N-diethyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | 4-bromo-N,N-diethyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 3339497 |
| Molecular Formula | C16H20BrN3O2S |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 4-bromo-N,N-diethyl-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | CCN(CC)C(=O)C1C2NC(=S)NC1(C)Oc1ccc(Br)cc12 |
| InChI | InChI=1S/C16H20BrN3O2S/c1-4-20(5-2)14(21)12-13-10-8-9(17)6-7-11(10)22-16(12,3)19-15(23)18-13/h6-8,12-13H,4-5H2,1-3H3,(H2,18,19,23) |
| InChIKey | IQOGXBBPZPCQLA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|