C22H24N4O — CID 3339911
N-naphthalen-2-yl-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carboxamide (PubChem CID 3339911) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-naphthalen-2-yl-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-naphthalen-2-yl-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 3339911 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-naphthalen-2-yl-4-(pyridin-4-ylmethyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)N1CCCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C22H24N4O/c27-22(24-21-7-6-19-4-1-2-5-20(19)16-21)26-13-3-12-25(14-15-26)17-18-8-10-23-11-9-18/h1-2,4-11,16H,3,12-15,17H2,(H,24,27) |
| InChIKey | NOPNWHFMZHPRFH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |