C4H13NO11P4 — CID 3340258
(2,6-dihydroxy-3,5-dimethyl-2,6-dioxo-5-phosphono-1,4,2λ5,6λ5-oxazadiphosphinan-3-yl)phosphonic acid (PubChem CID 3340258) has the molecular formula C4H13NO11P4 and a molecular weight of 375.04 g/mol. Its IUPAC name is (2,6-dihydroxy-3,5-dimethyl-2,6-dioxo-5-phosphono-1,4,2λ5,6λ5-oxazadiphosphinan-3-yl)phosphonic acid.
| Compound Name | (2,6-dihydroxy-3,5-dimethyl-2,6-dioxo-5-phosphono-1,4,2λ5,6λ5-oxazadiphosphinan-3-yl)phosphonic acid |
|---|---|
| PubChem CID | 3340258 |
| Molecular Formula | C4H13NO11P4 |
| Molecular Weight | 375.04 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | (2,6-dihydroxy-3,5-dimethyl-2,6-dioxo-5-phosphono-1,4,2λ5,6λ5-oxazadiphosphinan-3-yl)phosphonic acid |
| SMILES | CC1(P(=O)(O)O)NC(C)(P(=O)(O)O)P(=O)(O)OP1(=O)O |
| InChI | InChI=1S/C4H13NO11P4/c1-3(17(6,7)8)5-4(2,18(9,10)11)20(14,15)16-19(3,12)13/h5H,1-2H3,(H,12,13)(H,14,15)(H2,6,7,8)(H2,9,10,11) |
| InChIKey | OBFLWZKHMPTFRG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 210.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.04 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|