C15H23N3O4 — CID 33403782
3-[butyl(methyl)amino]-N-(2-methoxy-4-nitrophenyl)propanamide (PubChem CID 33403782) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-N-(2-methoxy-4-nitrophenyl)propanamide.
| Compound Name | 3-[butyl(methyl)amino]-N-(2-methoxy-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 33403782 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-[butyl(methyl)amino]-N-(2-methoxy-4-nitrophenyl)propanamide |
| SMILES | CCCCN(C)CCC(=O)Nc1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H23N3O4/c1-4-5-9-17(2)10-8-15(19)16-13-7-6-12(18(20)21)11-14(13)22-3/h6-7,11H,4-5,8-10H2,1-3H3,(H,16,19) |
| InChIKey | QDMPKFOZILDZLF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|