About 3-[(2-methylphenyl)methoxy]propane-1,2-diol
3-[(2-methylphenyl)methoxy]propane-1,2-diol (PubChem CID 3340577) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-[(2-methylphenyl)methoxy]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[(2-methylphenyl)methoxy]propane-1,2-diol |
| PubChem CID | 3340577 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-[(2-methylphenyl)methoxy]propane-1,2-diol |
| SMILES | Cc1ccccc1COCC(O)CO |
| InChI | InChI=1S/C11H16O3/c1-9-4-2-3-5-10(9)7-14-8-11(13)6-12/h2-5,11-13H,6-8H2,1H3 |
| InChIKey | PYDFXJCTDLAHDG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-methylphenyl)methoxy]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methylphenyl)methoxy]propane-1,2-diol?
The IUPAC name of 3-[(2-methylphenyl)methoxy]propane-1,2-diol (CID 3340577) is 3-[(2-methylphenyl)methoxy]propane-1,2-diol.
What is the SMILES notation for 3-[(2-methylphenyl)methoxy]propane-1,2-diol?
The canonical SMILES for 3-[(2-methylphenyl)methoxy]propane-1,2-diol is Cc1ccccc1COCC(O)CO.
What is the InChIKey of 3-[(2-methylphenyl)methoxy]propane-1,2-diol?
The InChIKey is PYDFXJCTDLAHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-9-4-2-3-5-10(9)7-14-8-11(13)6-12/h2-5,11-13H,6-8H2,1H3.
What are the key properties of 3-[(2-methylphenyl)methoxy]propane-1,2-diol?
3-[(2-methylphenyl)methoxy]propane-1,2-diol has a molecular weight of 196.25 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylphenyl)methoxy]propane-1,2-diol is sourced from PubChem (CID 3340577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).