C19H22N2O4 — CID 33406346
3-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 33406346) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 33406346 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-oxoethyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCCCCC2)C1=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C19H22N2O4/c22-15(13-5-6-16-14(11-13)7-10-25-16)12-21-17(23)19(20-18(21)24)8-3-1-2-4-9-19/h5-6,11H,1-4,7-10,12H2,(H,20,24) |
| InChIKey | GCBXTBVZUGNHIU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|