About [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate
[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate (PubChem CID 3341576) has the molecular formula C29H18Br4I2O4
and a molecular weight of 1003.88 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate.
Molecular Properties
| Compound Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate |
| PubChem CID | 3341576 |
| Molecular Formula | C29H18Br4I2O4 |
| Molecular Weight | 1003.88 g/mol |
| Exact Mass | 999.60 |
| IUPAC Name | [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate |
| SMILES | CC(C)(c1cc(Br)c(OC(=O)c2ccccc2I)c(Br)c1)c1cc(Br)c(OC(=O)c2ccccc2I)c(Br)c1 |
| InChI | InChI=1S/C29H18Br4I2O4/c1-29(2,15-11-19(30)25(20(31)12-15)38-27(36)17-7-3-5-9-23(17)34)16-13-21(32)26(22(33)14-16)39-28(37)18-8-4-6-10-24(18)35/h3-14H,1-2H3 |
| InChIKey | NNYKSZPTUMQPRJ-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1003.88 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate?
The IUPAC name of [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate (CID 3341576) is [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate.
What is the SMILES notation for [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate?
The canonical SMILES for [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate is CC(C)(c1cc(Br)c(OC(=O)c2ccccc2I)c(Br)c1)c1cc(Br)c(OC(=O)c2ccccc2I)c(Br)c1.
What is the InChIKey of [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate?
The InChIKey is NNYKSZPTUMQPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H18Br4I2O4/c1-29(2,15-11-19(30)25(20(31)12-15)38-27(36)17-7-3-5-9-23(17)34)16-13-21(32)26(22(33)14-16)39-28(37)18-8-4-6-10-24(18)35/h3-14H,1-2H3.
What are the key properties of [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate?
[2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate has a molecular weight of 1003.88 g/mol, XLogP of 10.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dibromo-4-[2-[3,5-dibromo-4-(2-iodobenzoyl)oxyphenyl]propan-2-yl]phenyl] 2-iodobenzoate is sourced from PubChem (CID 3341576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).