C28H23ClN4O3 — CID 3341826
1-(3-chlorophenyl)-3-ethyl-4-[4-(3-ethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]pyrazol-5-olate (PubChem CID 3341826) has the molecular formula C28H23ClN4O3 and a molecular weight of 498.97 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-ethyl-4-[4-(3-ethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]pyrazol-5-olate.
| Compound Name | 1-(3-chlorophenyl)-3-ethyl-4-[4-(3-ethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]pyrazol-5-olate |
|---|---|
| PubChem CID | 3341826 |
| Molecular Formula | C28H23ClN4O3 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-(3-chlorophenyl)-3-ethyl-4-[4-(3-ethylpyridin-1-ium-1-yl)-2,5-dioxo-1-phenylpyrrol-3-yl]pyrazol-5-olate |
| SMILES | CCc1ccc[n+](C2=C(c3c(CC)nn(-c4cccc(Cl)c4)c3[O-])C(=O)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C28H23ClN4O3/c1-3-18-10-9-15-31(17-18)25-24(26(34)32(28(25)36)20-12-6-5-7-13-20)23-22(4-2)30-33(27(23)35)21-14-8-11-19(29)16-21/h5-17H,3-4H2,1-2H3 |
| InChIKey | BGJRVYJZKDQMSG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|