C29H24ClN3O7S — CID 3342571
2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3342571) has the molecular formula C29H24ClN3O7S and a molecular weight of 594.05 g/mol. Its IUPAC name is 2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3342571 |
| Molecular Formula | C29H24ClN3O7S |
| Molecular Weight | 594.05 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | 2-methoxyethyl 5-(4-chlorophenyl)-7-methyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=c2sc(=Cc3ccc(-c4ccc([N+](=O)[O-])cc4C)o3)c(=O)n2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H24ClN3O7S/c1-16-14-20(33(36)37)8-10-22(16)23-11-9-21(40-23)15-24-27(34)32-26(18-4-6-19(30)7-5-18)25(17(2)31-29(32)41-24)28(35)39-13-12-38-3/h4-11,14-15,26H,12-13H2,1-3H3 |
| InChIKey | IORDMYJKZVDZTA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.05 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|