About 2-butylbenzotriazole
2-butylbenzotriazole (PubChem CID 3343351) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-butylbenzotriazole.
Molecular Properties
| Compound Name | 2-butylbenzotriazole |
| PubChem CID | 3343351 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-butylbenzotriazole |
| SMILES | CCCCn1nc2ccccc2n1 |
| InChI | InChI=1S/C10H13N3/c1-2-3-8-13-11-9-6-4-5-7-10(9)12-13/h4-7H,2-3,8H2,1H3 |
| InChIKey | DRFDQBZSCVSFKT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylbenzotriazole?
The IUPAC name of 2-butylbenzotriazole (CID 3343351) is 2-butylbenzotriazole.
What is the SMILES notation for 2-butylbenzotriazole?
The canonical SMILES for 2-butylbenzotriazole is CCCCn1nc2ccccc2n1.
What is the InChIKey of 2-butylbenzotriazole?
The InChIKey is DRFDQBZSCVSFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-2-3-8-13-11-9-6-4-5-7-10(9)12-13/h4-7H,2-3,8H2,1H3.
What are the key properties of 2-butylbenzotriazole?
2-butylbenzotriazole has a molecular weight of 175.24 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylbenzotriazole is sourced from PubChem (CID 3343351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).