C20H26N4O5S — CID 33435266
N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]acetamide (PubChem CID 33435266) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 33435266 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-2-[(4-methylphenyl)methylcarbamoylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)CNC(=O)NCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H26N4O5S/c1-15-3-5-16(6-4-15)13-22-20(26)23-14-19(25)21-11-12-24-30(27,28)18-9-7-17(29-2)8-10-18/h3-10,24H,11-14H2,1-2H3,(H,21,25)(H2,22,23,26) |
| InChIKey | OMRUFIIOHOLCPF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|