About N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine
N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 3343563) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 3343563 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCN(CC)C1=NC(C)CS1 |
| InChI | InChI=1S/C8H16N2S/c1-4-10(5-2)8-9-7(3)6-11-8/h7H,4-6H2,1-3H3 |
| InChIKey | ZHVHZPHWOGFZEB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine (CID 3343563) is N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine is CCN(CC)C1=NC(C)CS1.
What is the InChIKey of N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is ZHVHZPHWOGFZEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-4-10(5-2)8-9-7(3)6-11-8/h7H,4-6H2,1-3H3.
What are the key properties of N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine?
N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 172.30 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-methyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 3343563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).