C20H22Br2N2O4 — CID 3343767
N'-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]-2-(2-bromo-4-ethylphenoxy)acetohydrazide (PubChem CID 3343767) has the molecular formula C20H22Br2N2O4 and a molecular weight of 514.21 g/mol. Its IUPAC name is N'-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]-2-(2-bromo-4-ethylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]-2-(2-bromo-4-ethylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 3343767 |
| Molecular Formula | C20H22Br2N2O4 |
| Molecular Weight | 514.21 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | N'-[2-(4-bromo-2,6-dimethylphenoxy)acetyl]-2-(2-bromo-4-ethylphenoxy)acetohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)COc2c(C)cc(Br)cc2C)c(Br)c1 |
| InChI | InChI=1S/C20H22Br2N2O4/c1-4-14-5-6-17(16(22)9-14)27-10-18(25)23-24-19(26)11-28-20-12(2)7-15(21)8-13(20)3/h5-9H,4,10-11H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | VTTWXGLPGSYINX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.21 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|