About N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide
N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide (PubChem CID 3343997) has the molecular formula C21H18N2O2S
and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide.
Molecular Properties
| Compound Name | N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide |
| PubChem CID | 3343997 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide |
| SMILES | COc1cccc2s/c(=N\C(=O)Cc3cccc4ccccc34)n(C)c12 |
| InChI | InChI=1S/C21H18N2O2S/c1-23-20-17(25-2)11-6-12-18(20)26-21(23)22-19(24)13-15-9-5-8-14-7-3-4-10-16(14)15/h3-12H,13H2,1-2H3/b22-21- |
| InChIKey | FPQAHFQCDAQEOI-DQRAZIAOSA-N |
| XLogP | 4.07 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide?
The IUPAC name of N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide (CID 3343997) is N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide.
What is the SMILES notation for N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide?
The canonical SMILES for N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide is COc1cccc2s/c(=N\C(=O)Cc3cccc4ccccc34)n(C)c12.
What is the InChIKey of N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide?
The InChIKey is FPQAHFQCDAQEOI-DQRAZIAOSA-N. The full InChI is InChI=1S/C21H18N2O2S/c1-23-20-17(25-2)11-6-12-18(20)26-21(23)22-19(24)13-15-9-5-8-14-7-3-4-10-16(14)15/h3-12H,13H2,1-2H3/b22-21-.
What are the key properties of N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide?
N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide has a molecular weight of 362.45 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-naphthalen-1-ylacetamide is sourced from PubChem (CID 3343997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).