About 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one
6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one (PubChem CID 3344374) has the molecular formula C20H19NO3
and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one.
Molecular Properties
| Compound Name | 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one |
| PubChem CID | 3344374 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one |
| SMILES | O=C1CCCC(C2CN(C(=O)c3ccccc3)c3ccccc32)O1 |
| InChI | InChI=1S/C20H19NO3/c22-19-12-6-11-18(24-19)16-13-21(17-10-5-4-9-15(16)17)20(23)14-7-2-1-3-8-14/h1-5,7-10,16,18H,6,11-13H2 |
| InChIKey | GSHICMGYNOGEON-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one?
The IUPAC name of 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one (CID 3344374) is 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one.
What is the SMILES notation for 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one?
The canonical SMILES for 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one is O=C1CCCC(C2CN(C(=O)c3ccccc3)c3ccccc32)O1.
What is the InChIKey of 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one?
The InChIKey is GSHICMGYNOGEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO3/c22-19-12-6-11-18(24-19)16-13-21(17-10-5-4-9-15(16)17)20(23)14-7-2-1-3-8-14/h1-5,7-10,16,18H,6,11-13H2.
What are the key properties of 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one?
6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one has a molecular weight of 321.38 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-benzoyl-2,3-dihydroindol-3-yl)oxan-2-one is sourced from PubChem (CID 3344374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).