C39H35N3O7 — CID 3344446
5-(4-hydroxybut-1-ynyl)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide (PubChem CID 3344446) has the molecular formula C39H35N3O7 and a molecular weight of 657.72 g/mol. Its IUPAC name is 5-(4-hydroxybut-1-ynyl)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide.
| Compound Name | 5-(4-hydroxybut-1-ynyl)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide |
|---|---|
| PubChem CID | 3344446 |
| Molecular Formula | C39H35N3O7 |
| Molecular Weight | 657.72 g/mol |
| Exact Mass | 657.25 |
| IUPAC Name | 5-(4-hydroxybut-1-ynyl)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide |
| SMILES | NC(=O)C1C2C(=O)OC(c3ccccc3)C(c3ccccc3)N2C(c2ccc(OCCO)cc2)C12C(=O)Nc1ccc(C#CCCO)cc12 |
| InChI | InChI=1S/C39H35N3O7/c40-36(45)31-33-37(46)49-34(26-12-5-2-6-13-26)32(25-10-3-1-4-11-25)42(33)35(27-15-17-28(18-16-27)48-22-21-44)39(31)29-23-24(9-7-8-20-43)14-19-30(29)41-38(39)47/h1-6,10-19,23,31-35,43-44H,8,20-22H2,(H2,40,45)(H,41,47) |
| InChIKey | MTCOSWXGSAYVCO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|