About N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline
N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline (PubChem CID 3344562) has the molecular formula C12H8Cl2IN3
and a molecular weight of 392.03 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline.
Molecular Properties
| Compound Name | N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline |
| PubChem CID | 3344562 |
| Molecular Formula | C12H8Cl2IN3 |
| Molecular Weight | 392.03 g/mol |
| Exact Mass | 390.91 |
| IUPAC Name | N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline |
| SMILES | Clc1cccc(Cl)c1/N=N/Nc1ccccc1I |
| InChI | InChI=1S/C12H8Cl2IN3/c13-8-4-3-5-9(14)12(8)17-18-16-11-7-2-1-6-10(11)15/h1-7H,(H,16,17) |
| InChIKey | YJNQIRXDEHOMIN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.03 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline?
The IUPAC name of N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline (CID 3344562) is N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline.
What is the SMILES notation for N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline?
The canonical SMILES for N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline is Clc1cccc(Cl)c1/N=N/Nc1ccccc1I.
What is the InChIKey of N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline?
The InChIKey is YJNQIRXDEHOMIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2IN3/c13-8-4-3-5-9(14)12(8)17-18-16-11-7-2-1-6-10(11)15/h1-7H,(H,16,17).
What are the key properties of N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline?
N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline has a molecular weight of 392.03 g/mol, XLogP of 5.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-dichlorophenyl)diazenyl]-2-iodoaniline is sourced from PubChem (CID 3344562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).