About ethyl 2-benzylsulfanylacetate
ethyl 2-benzylsulfanylacetate (PubChem CID 3344750) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is ethyl 2-benzylsulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-benzylsulfanylacetate |
| PubChem CID | 3344750 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | ethyl 2-benzylsulfanylacetate |
| SMILES | CCOC(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C11H14O2S/c1-2-13-11(12)9-14-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | GRUYTQCKCHPMJF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-benzylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-benzylsulfanylacetate?
The IUPAC name of ethyl 2-benzylsulfanylacetate (CID 3344750) is ethyl 2-benzylsulfanylacetate.
What is the SMILES notation for ethyl 2-benzylsulfanylacetate?
The canonical SMILES for ethyl 2-benzylsulfanylacetate is CCOC(=O)CSCc1ccccc1.
What is the InChIKey of ethyl 2-benzylsulfanylacetate?
The InChIKey is GRUYTQCKCHPMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-2-13-11(12)9-14-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3.
What are the key properties of ethyl 2-benzylsulfanylacetate?
ethyl 2-benzylsulfanylacetate has a molecular weight of 210.30 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-benzylsulfanylacetate is sourced from PubChem (CID 3344750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).