About 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide
6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide (PubChem CID 3345054) has the molecular formula C12H10F3N3O4S
and a molecular weight of 349.29 g/mol. Its IUPAC name is 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 3345054 |
| Molecular Formula | C12H10F3N3O4S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F3N3O4S/c1-6-9(10(19)17-11(20)16-6)23(21,22)18-8-4-2-3-7(5-8)12(13,14)15/h2-5,18H,1H3,(H2,16,17,19,20) |
| InChIKey | VCFGFANDINPQKS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide?
The IUPAC name of 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide (CID 3345054) is 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide is Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide?
The InChIKey is VCFGFANDINPQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N3O4S/c1-6-9(10(19)17-11(20)16-6)23(21,22)18-8-4-2-3-7(5-8)12(13,14)15/h2-5,18H,1H3,(H2,16,17,19,20).
What are the key properties of 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide?
6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide has a molecular weight of 349.29 g/mol, XLogP of 1.19, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,4-dioxo-N-[3-(trifluoromethyl)phenyl]-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 3345054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).