C17H15FN2OS — CID 3345967
4-fluoro-N-(3,4,5-trimethyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 3345967) has the molecular formula C17H15FN2OS and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-fluoro-N-(3,4,5-trimethyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-fluoro-N-(3,4,5-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 3345967 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-fluoro-N-(3,4,5-trimethyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | Cc1ccc2s/c(=N\C(=O)c3ccc(F)cc3)n(C)c2c1C |
| InChI | InChI=1S/C17H15FN2OS/c1-10-4-9-14-15(11(10)2)20(3)17(22-14)19-16(21)12-5-7-13(18)8-6-12/h4-9H,1-3H3/b19-17- |
| InChIKey | COARGXKJHXQZER-ZPHPHTNESA-N |
| XLogP | 3.74 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |