C16H15NO — CID 3346379
2-(pyridin-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 3346379) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-(pyridin-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 3346379 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(pyridin-4-ylmethyl)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1c2ccccc2CCC1Cc1ccncc1 |
| InChI | InChI=1S/C16H15NO/c18-16-14(11-12-7-9-17-10-8-12)6-5-13-3-1-2-4-15(13)16/h1-4,7-10,14H,5-6,11H2 |
| InChIKey | LQEDVMDTNOBJHU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |