C13H7Cl3N2O4 — CID 3346463
3,5,6-trichloro-4-[(2,4-dihydroxyphenyl)methylideneamino]pyridine-2-carboxylic acid (PubChem CID 3346463) has the molecular formula C13H7Cl3N2O4 and a molecular weight of 361.57 g/mol. Its IUPAC name is 3,5,6-trichloro-4-[(2,4-dihydroxyphenyl)methylideneamino]pyridine-2-carboxylic acid.
| Compound Name | 3,5,6-trichloro-4-[(2,4-dihydroxyphenyl)methylideneamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 3346463 |
| Molecular Formula | C13H7Cl3N2O4 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 3,5,6-trichloro-4-[(2,4-dihydroxyphenyl)methylideneamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(Cl)c(Cl)c(/N=C/c2ccc(O)cc2O)c1Cl |
| InChI | InChI=1S/C13H7Cl3N2O4/c14-8-10(9(15)12(16)18-11(8)13(21)22)17-4-5-1-2-6(19)3-7(5)20/h1-4,19-20H,(H,21,22)/b17-4+ |
| InChIKey | RGJYKDIZPMUTCB-HAVNEIBRSA-N |
| XLogP | 3.90 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|