About 1,2-diethyl-1,2-diphenylhydrazine
1,2-diethyl-1,2-diphenylhydrazine (PubChem CID 3346567) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 1,2-diethyl-1,2-diphenylhydrazine.
Molecular Properties
| Compound Name | 1,2-diethyl-1,2-diphenylhydrazine |
| PubChem CID | 3346567 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1,2-diethyl-1,2-diphenylhydrazine |
| SMILES | CCN(c1ccccc1)N(CC)c1ccccc1 |
| InChI | InChI=1S/C16H20N2/c1-3-17(15-11-7-5-8-12-15)18(4-2)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | OHCIZKCZWUDEPU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethyl-1,2-diphenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-1,2-diphenylhydrazine?
The IUPAC name of 1,2-diethyl-1,2-diphenylhydrazine (CID 3346567) is 1,2-diethyl-1,2-diphenylhydrazine.
What is the SMILES notation for 1,2-diethyl-1,2-diphenylhydrazine?
The canonical SMILES for 1,2-diethyl-1,2-diphenylhydrazine is CCN(c1ccccc1)N(CC)c1ccccc1.
What is the InChIKey of 1,2-diethyl-1,2-diphenylhydrazine?
The InChIKey is OHCIZKCZWUDEPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2/c1-3-17(15-11-7-5-8-12-15)18(4-2)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3.
What are the key properties of 1,2-diethyl-1,2-diphenylhydrazine?
1,2-diethyl-1,2-diphenylhydrazine has a molecular weight of 240.35 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-1,2-diphenylhydrazine is sourced from PubChem (CID 3346567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).