C30H26N4O2 — CID 3347323
6-[2-(1H-indol-3-yl)ethyl]-2-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 3347323) has the molecular formula C30H26N4O2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 6-[2-(1H-indol-3-yl)ethyl]-2-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 6-[2-(1H-indol-3-yl)ethyl]-2-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 3347323 |
| Molecular Formula | C30H26N4O2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 6-[2-(1H-indol-3-yl)ethyl]-2-phenyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1C2Cc3c([nH]c4ccccc34)C(c3ccccc3)N2C(=O)CN1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H26N4O2/c35-27-18-33(15-14-20-17-31-24-12-6-4-10-21(20)24)30(36)26-16-23-22-11-5-7-13-25(22)32-28(23)29(34(26)27)19-8-2-1-3-9-19/h1-13,17,26,29,31-32H,14-16,18H2 |
| InChIKey | WGFZKAYNSUSATJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|