About 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide
2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide (PubChem CID 3347797) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide |
| PubChem CID | 3347797 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide |
| SMILES | CC1(C)c2ccccc2N(CC(N)=O)C12C=Cc1ccccc1O2 |
| InChI | InChI=1S/C20H20N2O2/c1-19(2)15-8-4-5-9-16(15)22(13-18(21)23)20(19)12-11-14-7-3-6-10-17(14)24-20/h3-12H,13H2,1-2H3,(H2,21,23) |
| InChIKey | MIUAWLSDZITJFD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide?
The IUPAC name of 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide (CID 3347797) is 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide.
What is the SMILES notation for 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide?
The canonical SMILES for 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide is CC1(C)c2ccccc2N(CC(N)=O)C12C=Cc1ccccc1O2.
What is the InChIKey of 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide?
The InChIKey is MIUAWLSDZITJFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2/c1-19(2)15-8-4-5-9-16(15)22(13-18(21)23)20(19)12-11-14-7-3-6-10-17(14)24-20/h3-12H,13H2,1-2H3,(H2,21,23).
What are the key properties of 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide?
2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide has a molecular weight of 320.39 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl)acetamide is sourced from PubChem (CID 3347797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).