C43H53F2NO7 — CID 3347940
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(3-methoxypropyl)acetamide (PubChem CID 3347940) has the molecular formula C43H53F2NO7 and a molecular weight of 733.89 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(3-methoxypropyl)acetamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 3347940 |
| Molecular Formula | C43H53F2NO7 |
| Molecular Weight | 733.89 g/mol |
| Exact Mass | 733.38 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCN(CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C)C(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C43H53F2NO7/c1-28-8-6-18-42(2)35(33-14-10-29(22-32(47)13-9-28)23-34(33)41(49)31-12-15-36(44)37(45)26-31)17-19-43(42,50)27-46(20-7-21-51-3)40(48)25-30-11-16-38(52-4)39(24-30)53-5/h8,10-12,14-16,23-24,26,32,35,47,50H,6-7,9,13,17-22,25,27H2,1-5H3 |
| InChIKey | VKLPSOAQUUPARK-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.89 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|