C22H20ClNO4S — CID 33482790
2-(2-benzyl-4-chlorophenoxy)-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 33482790) has the molecular formula C22H20ClNO4S and a molecular weight of 429.93 g/mol. Its IUPAC name is 2-(2-benzyl-4-chlorophenoxy)-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-benzyl-4-chlorophenoxy)-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 33482790 |
| Molecular Formula | C22H20ClNO4S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-(2-benzyl-4-chlorophenoxy)-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20ClNO4S/c1-29(26,27)20-10-8-19(9-11-20)24-22(25)15-28-21-12-7-18(23)14-17(21)13-16-5-3-2-4-6-16/h2-12,14H,13,15H2,1H3,(H,24,25) |
| InChIKey | VBDBHAPOAWLHDP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |