C17H19ClN2O6S — CID 3348458
5-tert-butyl-3-(carboxymethyl)-1-(5-chlorothiophen-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3348458) has the molecular formula C17H19ClN2O6S and a molecular weight of 414.87 g/mol. Its IUPAC name is 5-tert-butyl-3-(carboxymethyl)-1-(5-chlorothiophen-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-tert-butyl-3-(carboxymethyl)-1-(5-chlorothiophen-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3348458 |
| Molecular Formula | C17H19ClN2O6S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 5-tert-butyl-3-(carboxymethyl)-1-(5-chlorothiophen-2-yl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C)N1C(=O)C2C(c3ccc(Cl)s3)NC(CC(=O)O)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C17H19ClN2O6S/c1-16(2,3)20-13(23)10-11(14(20)24)17(15(25)26,6-9(21)22)19-12(10)7-4-5-8(18)27-7/h4-5,10-12,19H,6H2,1-3H3,(H,21,22)(H,25,26) |
| InChIKey | PXPDERXGJMMCAG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|