C26H23N3O5 — CID 33486051
[2-oxo-2-(2-phenoxyanilino)ethyl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate (PubChem CID 33486051) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyanilino)ethyl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate.
| Compound Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate |
|---|---|
| PubChem CID | 33486051 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 3-(8-methyl-4-oxoquinazolin-3-yl)propanoate |
| SMILES | Cc1cccc2c(=O)n(CCC(=O)OCC(=O)Nc3ccccc3Oc3ccccc3)cnc12 |
| InChI | InChI=1S/C26H23N3O5/c1-18-8-7-11-20-25(18)27-17-29(26(20)32)15-14-24(31)33-16-23(30)28-21-12-5-6-13-22(21)34-19-9-3-2-4-10-19/h2-13,17H,14-16H2,1H3,(H,28,30) |
| InChIKey | AILVSJBJOXRCQH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |