C24H30O6 — CID 3348725
1,8-bis(5-ethoxy-2-hydroxyphenyl)octane-1,8-dione (PubChem CID 3348725) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 1,8-bis(5-ethoxy-2-hydroxyphenyl)octane-1,8-dione.
| Compound Name | 1,8-bis(5-ethoxy-2-hydroxyphenyl)octane-1,8-dione |
|---|---|
| PubChem CID | 3348725 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1,8-bis(5-ethoxy-2-hydroxyphenyl)octane-1,8-dione |
| SMILES | CCOc1ccc(O)c(C(=O)CCCCCCC(=O)c2cc(OCC)ccc2O)c1 |
| InChI | InChI=1S/C24H30O6/c1-3-29-17-11-13-23(27)19(15-17)21(25)9-7-5-6-8-10-22(26)20-16-18(30-4-2)12-14-24(20)28/h11-16,27-28H,3-10H2,1-2H3 |
| InChIKey | KFUAJKSVRIIVGE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|