C14H11Cl4N3O3 — CID 3349176
4-chloro-N-[2,2,2-trichloro-1-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]benzamide (PubChem CID 3349176) has the molecular formula C14H11Cl4N3O3 and a molecular weight of 411.07 g/mol. Its IUPAC name is 4-chloro-N-[2,2,2-trichloro-1-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]benzamide.
| Compound Name | 4-chloro-N-[2,2,2-trichloro-1-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 3349176 |
| Molecular Formula | C14H11Cl4N3O3 |
| Molecular Weight | 411.07 g/mol |
| Exact Mass | 408.96 |
| IUPAC Name | 4-chloro-N-[2,2,2-trichloro-1-(6-methyl-2,4-dioxo-1H-pyrimidin-3-yl)ethyl]benzamide |
| SMILES | Cc1cc(=O)n(C(NC(=O)c2ccc(Cl)cc2)C(Cl)(Cl)Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C14H11Cl4N3O3/c1-7-6-10(22)21(13(24)19-7)12(14(16,17)18)20-11(23)8-2-4-9(15)5-3-8/h2-6,12H,1H3,(H,19,24)(H,20,23) |
| InChIKey | XFLKNKOHBPRJHA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.07 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|