C10H8ClN5S — CID 3349214
N'-[4-chloro-5-(2,2-dicyanoethenyl)-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 3349214) has the molecular formula C10H8ClN5S and a molecular weight of 265.73 g/mol. Its IUPAC name is N'-[4-chloro-5-(2,2-dicyanoethenyl)-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-chloro-5-(2,2-dicyanoethenyl)-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 3349214 |
| Molecular Formula | C10H8ClN5S |
| Molecular Weight | 265.73 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | N'-[4-chloro-5-(2,2-dicyanoethenyl)-1,3-thiazol-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1nc(Cl)c(C=C(C#N)C#N)s1 |
| InChI | InChI=1S/C10H8ClN5S/c1-16(2)6-14-10-15-9(11)8(17-10)3-7(4-12)5-13/h3,6H,1-2H3 |
| InChIKey | CKNOVQNJNBZDMB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.73 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|