C25H26N2O4 — CID 33498608
4-oxo-4-(4-propoxyphenyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]butanamide (PubChem CID 33498608) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 4-oxo-4-(4-propoxyphenyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]butanamide.
| Compound Name | 4-oxo-4-(4-propoxyphenyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 33498608 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-oxo-4-(4-propoxyphenyl)-N-[3-(pyridin-2-ylmethoxy)phenyl]butanamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)Nc2cccc(OCc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-2-16-30-22-11-9-19(10-12-22)24(28)13-14-25(29)27-20-7-5-8-23(17-20)31-18-21-6-3-4-15-26-21/h3-12,15,17H,2,13-14,16,18H2,1H3,(H,27,29) |
| InChIKey | KXCHRDULOMBGCP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |