About N-prop-2-enylnonanamide
N-prop-2-enylnonanamide (PubChem CID 3349902) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is N-prop-2-enylnonanamide.
Molecular Properties
| Compound Name | N-prop-2-enylnonanamide |
| PubChem CID | 3349902 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-prop-2-enylnonanamide |
| SMILES | C=CCNC(=O)CCCCCCCC |
| InChI | InChI=1S/C12H23NO/c1-3-5-6-7-8-9-10-12(14)13-11-4-2/h4H,2-3,5-11H2,1H3,(H,13,14) |
| InChIKey | CAXZCFQSMKMBNV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enylnonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enylnonanamide?
The IUPAC name of N-prop-2-enylnonanamide (CID 3349902) is N-prop-2-enylnonanamide.
What is the SMILES notation for N-prop-2-enylnonanamide?
The canonical SMILES for N-prop-2-enylnonanamide is C=CCNC(=O)CCCCCCCC.
What is the InChIKey of N-prop-2-enylnonanamide?
The InChIKey is CAXZCFQSMKMBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-3-5-6-7-8-9-10-12(14)13-11-4-2/h4H,2-3,5-11H2,1H3,(H,13,14).
What are the key properties of N-prop-2-enylnonanamide?
N-prop-2-enylnonanamide has a molecular weight of 197.32 g/mol, XLogP of 3.04, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enylnonanamide is sourced from PubChem (CID 3349902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).