C20H23FN4OS2 — CID 33499928
[2-[[3-cyano-1-(4-fluorophenyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 33499928) has the molecular formula C20H23FN4OS2 and a molecular weight of 418.56 g/mol. Its IUPAC name is [2-[[3-cyano-1-(4-fluorophenyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[[3-cyano-1-(4-fluorophenyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 33499928 |
| Molecular Formula | C20H23FN4OS2 |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-[[3-cyano-1-(4-fluorophenyl)-4,5-dimethylpyrrol-2-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1c(C#N)c(C)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN4OS2/c1-5-24(6-2)20(27)28-12-18(26)23-19-17(11-22)13(3)14(4)25(19)16-9-7-15(21)8-10-16/h7-10H,5-6,12H2,1-4H3,(H,23,26) |
| InChIKey | ZDNVVKNDZOMEOV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|