C11H21N3S — CID 3350153
5-(2,3-dimethylcyclohexyl)-1,3,5-triazinane-2-thione (PubChem CID 3350153) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-(2,3-dimethylcyclohexyl)-1,3,5-triazinane-2-thione.
| Compound Name | 5-(2,3-dimethylcyclohexyl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 3350153 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-(2,3-dimethylcyclohexyl)-1,3,5-triazinane-2-thione |
| SMILES | CC1CCCC(N2CNC(=S)NC2)C1C |
| InChI | InChI=1S/C11H21N3S/c1-8-4-3-5-10(9(8)2)14-6-12-11(15)13-7-14/h8-10H,3-7H2,1-2H3,(H2,12,13,15) |
| InChIKey | MTYRAVRZCHGACG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|