About N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide
N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide (PubChem CID 3350277) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide |
| PubChem CID | 3350277 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide |
| SMILES | CCOc1ccc(OCCCC(=O)NC2=NCCS2)cc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-2-19-12-5-7-13(8-6-12)20-10-3-4-14(18)17-15-16-9-11-21-15/h5-8H,2-4,9-11H2,1H3,(H,16,17,18) |
| InChIKey | IOQOARLOIBZNMB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide?
The IUPAC name of N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide (CID 3350277) is N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide.
What is the SMILES notation for N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide?
The canonical SMILES for N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide is CCOc1ccc(OCCCC(=O)NC2=NCCS2)cc1.
What is the InChIKey of N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide?
The InChIKey is IOQOARLOIBZNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-2-19-12-5-7-13(8-6-12)20-10-3-4-14(18)17-15-16-9-11-21-15/h5-8H,2-4,9-11H2,1H3,(H,16,17,18).
What are the key properties of N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide?
N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide has a molecular weight of 308.40 g/mol, XLogP of 2.46, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1,3-thiazol-2-yl)-4-(4-ethoxyphenoxy)butanamide is sourced from PubChem (CID 3350277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).