C9H5F7N2O — CID 3350460
2,2,3,3,4,4,4-heptafluoro-N-pyridin-2-ylbutanamide (PubChem CID 3350460) has the molecular formula C9H5F7N2O and a molecular weight of 290.14 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-pyridin-2-ylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 3350460 |
| Molecular Formula | C9H5F7N2O |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-pyridin-2-ylbutanamide |
| SMILES | O=C(Nc1ccccn1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F7N2O/c10-7(11,8(12,13)9(14,15)16)6(19)18-5-3-1-2-4-17-5/h1-4H,(H,17,18,19) |
| InChIKey | PDIASJVTCFSDDH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|