About N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide (PubChem CID 3351089) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide.
Molecular Properties
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide |
| PubChem CID | 3351089 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2=NCCC2)c1)C1CCC1 |
| InChI | InChI=1S/C15H19N3O3S/c19-15(11-4-1-5-11)17-12-6-2-7-13(10-12)22(20,21)18-14-8-3-9-16-14/h2,6-7,10-11H,1,3-5,8-9H2,(H,16,18)(H,17,19) |
| InChIKey | QBVWHTFWFHBDBV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide?
The IUPAC name of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide (CID 3351089) is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide.
What is the SMILES notation for N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide?
The canonical SMILES for N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide is O=C(Nc1cccc(S(=O)(=O)NC2=NCCC2)c1)C1CCC1.
What is the InChIKey of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide?
The InChIKey is QBVWHTFWFHBDBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S/c19-15(11-4-1-5-11)17-12-6-2-7-13(10-12)22(20,21)18-14-8-3-9-16-14/h2,6-7,10-11H,1,3-5,8-9H2,(H,16,18)(H,17,19).
What are the key properties of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide?
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide has a molecular weight of 321.40 g/mol, XLogP of 1.90, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]cyclobutanecarboxamide is sourced from PubChem (CID 3351089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).