C26H20ClNO3 — CID 3351282
2-(4-chlorophenyl)-4-hydroxy-1-(3-methylphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 3351282) has the molecular formula C26H20ClNO3 and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-hydroxy-1-(3-methylphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-hydroxy-1-(3-methylphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3351282 |
| Molecular Formula | C26H20ClNO3 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4-hydroxy-1-(3-methylphenyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | Cc1cccc(N2C(=O)C(O)=C(C(=O)C=Cc3ccccc3)C2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C26H20ClNO3/c1-17-6-5-9-21(16-17)28-24(19-11-13-20(27)14-12-19)23(25(30)26(28)31)22(29)15-10-18-7-3-2-4-8-18/h2-16,24,30H,1H3 |
| InChIKey | WUAROROZZYANGT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|