About N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide
N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 3351751) has the molecular formula C20H15N3O3S
and a molecular weight of 377.43 g/mol. Its IUPAC name is N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide.
Molecular Properties
| Compound Name | N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide |
| PubChem CID | 3351751 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1ccn2c(NC(=O)c3ccc4c(c3)OCO4)c(-c3cccs3)nc2c1 |
| InChI | InChI=1S/C20H15N3O3S/c1-12-6-7-23-17(9-12)21-18(16-3-2-8-27-16)19(23)22-20(24)13-4-5-14-15(10-13)26-11-25-14/h2-10H,11H2,1H3,(H,22,24) |
| InChIKey | QIXVGDJNXCHJPB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide?
The IUPAC name of N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide (CID 3351751) is N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide.
What is the SMILES notation for N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide?
The canonical SMILES for N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide is Cc1ccn2c(NC(=O)c3ccc4c(c3)OCO4)c(-c3cccs3)nc2c1.
What is the InChIKey of N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide?
The InChIKey is QIXVGDJNXCHJPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O3S/c1-12-6-7-23-17(9-12)21-18(16-3-2-8-27-16)19(23)22-20(24)13-4-5-14-15(10-13)26-11-25-14/h2-10H,11H2,1H3,(H,22,24).
What are the key properties of N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide?
N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide has a molecular weight of 377.43 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-methyl-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)-1,3-benzodioxole-5-carboxamide is sourced from PubChem (CID 3351751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).