C30H23ClN4O3S — CID 3351787
2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(3-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 3351787) has the molecular formula C30H23ClN4O3S and a molecular weight of 555.06 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(3-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(3-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3351787 |
| Molecular Formula | C30H23ClN4O3S |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(3-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1)NN=Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H23ClN4O3S/c31-23-13-15-24(16-14-23)35-29(37)26-11-4-5-12-27(26)33-30(35)39-20-28(36)34-32-18-22-9-6-10-25(17-22)38-19-21-7-2-1-3-8-21/h1-18H,19-20H2,(H,34,36) |
| InChIKey | DRIWEMSAXUEXRZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|