C38H43ClFNO3 — CID 3352059
2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone (PubChem CID 3352059) has the molecular formula C38H43ClFNO3 and a molecular weight of 616.22 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
|---|---|
| PubChem CID | 3352059 |
| Molecular Formula | C38H43ClFNO3 |
| Molecular Weight | 616.22 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]ethanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2Cc3ccccc3C2)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C38H43ClFNO3/c1-25-7-6-17-37(2)33(16-18-38(37,44)24-41-22-27-8-3-4-9-28(27)23-41)30-15-13-26(19-29(42)14-12-25)20-31(30)36(43)21-32-34(39)10-5-11-35(32)40/h3-5,7-11,13,15,20,29,33,42,44H,6,12,14,16-19,21-24H2,1-2H3 |
| InChIKey | DACBSKXNZOFTBX-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.22 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|