C36H47F2NO6 — CID 3352061
ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate (PubChem CID 3352061) has the molecular formula C36H47F2NO6 and a molecular weight of 627.77 g/mol. Its IUPAC name is ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate.
| Compound Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 3352061 |
| Molecular Formula | C36H47F2NO6 |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
| SMILES | CCOC(=O)N(CCCOC)CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C36H47F2NO6/c1-5-45-34(42)39(18-7-19-44-4)23-36(43)17-15-30-28-13-10-25(20-27(40)12-9-24(2)8-6-16-35(30,36)3)21-29(28)33(41)26-11-14-31(37)32(38)22-26/h8,10-11,13-14,21-22,27,30,40,43H,5-7,9,12,15-20,23H2,1-4H3 |
| InChIKey | PNEOZPQSJVEVAN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|