C11H14F8N2O2 — CID 3352188
2,2,3,3,4,4,5,5-octafluoro-N-(2-morpholin-4-ylethyl)pentanamide (PubChem CID 3352188) has the molecular formula C11H14F8N2O2 and a molecular weight of 358.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N-(2-morpholin-4-ylethyl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N-(2-morpholin-4-ylethyl)pentanamide |
|---|---|
| PubChem CID | 3352188 |
| Molecular Formula | C11H14F8N2O2 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N-(2-morpholin-4-ylethyl)pentanamide |
| SMILES | O=C(NCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H14F8N2O2/c12-7(13)9(14,15)11(18,19)10(16,17)8(22)20-1-2-21-3-5-23-6-4-21/h7H,1-6H2,(H,20,22) |
| InChIKey | ZFXOUQXHIHRZBF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|